CAS 757221-05-9 is the registry number for N-(4-(Chloromethyl)-1,3-thiazol-2-yl)-N-ethylacetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide (CAS 757221-05-9) is a chemical compound with the molecular formula C8H11ClN2OS and a molecular weight of 218.70 g/mol. IUPAC name: N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide. InChIKey: QAHGTFJTWCLCBX-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2OS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-ethylacetamide |
| InChIKey | QAHGTFJTWCLCBX-UHFFFAOYSA-N |
| SMILES | CCN(C1=NC(=CS1)CCl)C(=O)C |
Computed by PubChem (NCBI)