CAS 1443979-72-3 is the registry number for 6-Amino-4H,5H,6H,7H,8H-thieno(3,2-b)azepin-5-one hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg.
6-amino-4,6,7,8-tetrahydrothieno[3,2-b]azepin-5-one;hydrochloride (CAS 1443979-72-3) is a chemical compound with the molecular formula C8H11ClN2OS and a molecular weight of 218.70 g/mol. IUPAC name: 6-amino-4,6,7,8-tetrahydrothieno[3,2-b]azepin-5-one;hydrochloride. InChIKey: RRRGPCFKJJODFY-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2OS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 6-amino-4,6,7,8-tetrahydrothieno[3,2-b]azepin-5-one;hydrochloride |
| InChIKey | RRRGPCFKJJODFY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CS2)NC(=O)C1N.Cl |
Computed by PubChem (NCBI)