CAS 96490-18-5 is the registry number for 4-Chloro-2-(1,1-dimethylethyl)-5-mercapto-3(2H)-pyridazinone. Offered by: TRC. Available pack sizes: 2,5g.
2-tert-butyl-4-chloro-5-sulfanylpyridazin-3-one (CAS 96490-18-5) is a chemical compound with the molecular formula C8H11ClN2OS and a molecular weight of 218.70 g/mol. IUPAC name: 2-tert-butyl-4-chloro-5-sulfanylpyridazin-3-one. InChIKey: GLGQMFICPMIOHO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2OS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 2-tert-butyl-4-chloro-5-sulfanylpyridazin-3-one |
| InChIKey | GLGQMFICPMIOHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)C(=C(C=N1)S)Cl |
Computed by PubChem (NCBI)