CAS 878437-08-2 is the registry number for 2-Chloro-N-(4-ethyl-5-methylthiazol-2-yl)acetamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide (CAS 878437-08-2) is a chemical compound with the molecular formula C8H11ClN2OS and a molecular weight of 218.70 g/mol. IUPAC name: 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide. InChIKey: MSHQDDQHSXQNNX-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2OS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)acetamide |
| InChIKey | MSHQDDQHSXQNNX-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=N1)NC(=O)CCl)C |
Computed by PubChem (NCBI)