Products 1291666-88-0
CAS 1291666-88-0 is the registry number for 2-(((5-Chlorothiophen-2-yl)methyl)(methyl)amino)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide (CAS 1291666-88-0) is a chemical compound with the molecular formula C8H11ClN2OS and a molecular weight of 218.70 g/mol. IUPAC name: 2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide. InChIKey: PMRWCSJZBBZPSO-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2OS |
|---|---|
| Molecular weight | 218.70 g/mol |
| IUPAC name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]acetamide |
| InChIKey | PMRWCSJZBBZPSO-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(S1)Cl)CC(=O)N |
Computed by PubChem (NCBI)