Products 128162-85-6
CAS 128162-85-6 is the registry number for (1S)-1-(2,5-dimethoxyphenyl) ethanamine hydrochlride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2,5-dimethoxyphenyl)ethanamine;hydrochloride (CAS 128162-85-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1S)-1-(2,5-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: XWPHMTMVZQIRHG-FJXQXJEOSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1S)-1-(2,5-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | XWPHMTMVZQIRHG-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)