CAS 128173-43-3 appears in our catalog under these names: 2-Cyano-N-(1-(2,4-dichlorophenyl)ethyl)acetamide, 95%, 2-Cyano-N-(1-(2,4-dichlorophenyl)ethyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-cyano-N-[1-(2,4-dichlorophenyl)ethyl]acetamide (CAS 128173-43-3) is a chemical compound with the molecular formula C11H10Cl2N2O and a molecular weight of 257.11 g/mol. IUPAC name: 2-cyano-N-[1-(2,4-dichlorophenyl)ethyl]acetamide. InChIKey: OJVSVGOYUZEMQH-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 2-cyano-N-[1-(2,4-dichlorophenyl)ethyl]acetamide |
| InChIKey | OJVSVGOYUZEMQH-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)NC(=O)CC#N |
Computed by PubChem (NCBI)