CAS 27646-28-2 is the registry number for (S)-Desallyl Imazalil. Offered by: TRC. Available pack sizes: 250mg.
(1S)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol (CAS 27646-28-2) is a chemical compound with the molecular formula C11H10Cl2N2O and a molecular weight of 257.11 g/mol. IUPAC name: (1S)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol. InChIKey: UKVLTPAGJIYSGN-LLVKDONJSA-N.
| Molecular formula | C11H10Cl2N2O |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | (1S)-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethanol |
| InChIKey | UKVLTPAGJIYSGN-LLVKDONJSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[C@@H](CN2C=CN=C2)O |
Computed by PubChem (NCBI)