Products 507487-25-4
CAS 507487-25-4 is the registry number for 3-Chloro-5-(chloromethyl)-8-oxa-4,6-diazatricyclo[7.4.0.0(2,7)]trideca-1(9),2,4,6-tetraene, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4-chloro-2-(chloromethyl)-5,6,7,8-tetrahydro-[1]benzofuro[2,3-d]pyrimidine (CAS 507487-25-4) is a chemical compound with the molecular formula C11H10Cl2N2O and a molecular weight of 257.11 g/mol. IUPAC name: 4-chloro-2-(chloromethyl)-5,6,7,8-tetrahydro-[1]benzofuro[2,3-d]pyrimidine. InChIKey: ZDYOKELKTJJDIY-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 4-chloro-2-(chloromethyl)-5,6,7,8-tetrahydro-[1]benzofuro[2,3-d]pyrimidine |
| InChIKey | ZDYOKELKTJJDIY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(O2)N=C(N=C3Cl)CCl |
Computed by PubChem (NCBI)