CAS 27523-06-4 appears in our catalog under these names: 1-(2, 5-Dichlorophenyl)-2-(1H-Imidazole-1-yl)-Ethanol, 1-(2,5-dichlorophenyl)-2-(1H-imidazol-1-yl)ethanol. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,5-dichlorophenyl)-2-imidazol-1-ylethanol (CAS 27523-06-4) is a chemical compound with the molecular formula C11H10Cl2N2O and a molecular weight of 257.11 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)-2-imidazol-1-ylethanol. InChIKey: VBPAZUODEGXWRA-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)-2-imidazol-1-ylethanol |
| InChIKey | VBPAZUODEGXWRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(CN2C=CN=C2)O)Cl |
Computed by PubChem (NCBI)