CAS 2874373-65-4 is the registry number for (S)-5,6-Dichlorospiro[indoline-3,3'-pyrrolidin]-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-5,6-dichlorospiro[1H-indole-3,3'-pyrrolidine]-2-one (CAS 2874373-65-4) is a chemical compound with the molecular formula C11H10Cl2N2O and a molecular weight of 257.11 g/mol. IUPAC name: (3S)-5,6-dichlorospiro[1H-indole-3,3'-pyrrolidine]-2-one. InChIKey: DHWSEZQLEXDMEK-LLVKDONJSA-N.
| Molecular formula | C11H10Cl2N2O |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | (3S)-5,6-dichlorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
| InChIKey | DHWSEZQLEXDMEK-LLVKDONJSA-N |
| SMILES | C1CNC[C@@]12C3=CC(=C(C=C3NC2=O)Cl)Cl |
Computed by PubChem (NCBI)