CAS 98042-34-3 is the registry number for 2-Chloro-N-(3-chlorophenyl)-N-(2-cyanoethyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(3-chlorophenyl)-N-(2-cyanoethyl)acetamide (CAS 98042-34-3) is a chemical compound with the molecular formula C11H10Cl2N2O and a molecular weight of 257.11 g/mol. IUPAC name: 2-chloro-N-(3-chlorophenyl)-N-(2-cyanoethyl)acetamide. InChIKey: QOVLCWIMQANPGW-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2N2O |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 2-chloro-N-(3-chlorophenyl)-N-(2-cyanoethyl)acetamide |
| InChIKey | QOVLCWIMQANPGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N(CCC#N)C(=O)CCl |
Computed by PubChem (NCBI)