Products 1281900-64-8
CAS 1281900-64-8 appears in our catalog under these names: 3-((Carboxy(phenyl)methyl)amino)-3-oxopropanoic acid, 95%, 95%, 3-((Carboxy(phenyl)methyl)amino)-3-oxopropanoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[[carboxy(phenyl)methyl]amino]-3-oxopropanoic acid (CAS 1281900-64-8) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: 3-[[carboxy(phenyl)methyl]amino]-3-oxopropanoic acid. InChIKey: MLJSTRLJXCSFMF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 3-[[carboxy(phenyl)methyl]amino]-3-oxopropanoic acid |
| InChIKey | MLJSTRLJXCSFMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NC(=O)CC(=O)O |
Computed by PubChem (NCBI)