CAS 128223-55-2 appears in our catalog under these names: (2R,3R)-3-Amino-2-hydroxy-4-phenylbutanoic acid, 95%, (2S,3R)-3-Amino-2-hydroxy-4-phenylbutyric acid hydrochloride, 95%, (2S,3R)-3-Amino-2-hydroxy-4-phenylbutanoic acid hydrochloride, 95+%, (2S,3R)-3-Amino-2-hydroxy-4-phenyl-butyric acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
(2S,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride (CAS 128223-55-2) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride. InChIKey: OPVMPYQFOLATCK-RJUBDTSPSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | (2S,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride |
| InChIKey | OPVMPYQFOLATCK-RJUBDTSPSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H]([C@@H](C(=O)O)O)N.Cl |
Computed by PubChem (NCBI)