CAS 129593-20-0 is the registry number for Bestatin Impurity 3 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride (CAS 129593-20-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride. InChIKey: OPVMPYQFOLATCK-OZZZDHQUSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride |
| InChIKey | OPVMPYQFOLATCK-OZZZDHQUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]([C@@H](C(=O)O)O)N.Cl |
Computed by PubChem (NCBI)