Products 129593-20-0

CAS 129593-20-0 is the registry number for Bestatin Impurity 3 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride (CAS 129593-20-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: (2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride. InChIKey: OPVMPYQFOLATCK-OZZZDHQUSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC name(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid;hydrochloride
InChIKeyOPVMPYQFOLATCK-OZZZDHQUSA-N
SMILESC1=CC=C(C=C1)C[C@@H]([C@@H](C(=O)O)O)N.Cl

Computed by PubChem (NCBI)