Products 1283108-69-9
CAS 1283108-69-9 appears in our catalog under these names: 1-(Benzo(d)thiazol-2-yl)azetidine-3-carboxylic acid, 97%, 1-(1,3-Benzothiazol-2-yl)azetidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 100mg, 50mg, 250mg, 1000mg, 500mg.
1-(1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid (CAS 1283108-69-9) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid. InChIKey: PJWDFJKGYQREOW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 1-(1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid |
| InChIKey | PJWDFJKGYQREOW-UHFFFAOYSA-N |
| SMILES | C1C(CN1C2=NC3=CC=CC=C3S2)C(=O)O |
Computed by PubChem (NCBI)