CAS 128486-09-9 appears in our catalog under these names: 1-(3-Chlorophenyl)-1,3-butanedione, 95%, 1-(3-Chlorophenyl)butane-1,3-dione, 1-(3-chlorophenyl)-3-hydroxybut-2-en-1-one, 95%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 0,5g, 250mg.
1-(3-chlorophenyl)butane-1,3-dione (CAS 128486-09-9) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 1-(3-chlorophenyl)butane-1,3-dione. InChIKey: NAVKHJDRCGTULV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-(3-chlorophenyl)butane-1,3-dione |
| InChIKey | NAVKHJDRCGTULV-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)