CAS 1285372-60-2 appears in our catalog under these names: 3-(3,5-Dimethyl-1h-pyrazol-4-yl)propanoic acid hydrochloride, 95%, 3-(3,5-Dimethyl-1H-pyrazol-4-yl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 0,5g.
3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride (CAS 1285372-60-2) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride. InChIKey: SNDJYEDBCIBMSS-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid;hydrochloride |
| InChIKey | SNDJYEDBCIBMSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)CCC(=O)O.Cl |
Computed by PubChem (NCBI)