Products 1305320-57-3

CAS 1305320-57-3 appears in our catalog under these names: Ethyl 3,5-dimethylpyrazole-4-carboxylate hydrochloride, 95%, Ethyl 3,5-dimethylpyrazole-4-carboxylate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate;hydrochloride (CAS 1305320-57-3) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate;hydrochloride. InChIKey: QZGZCHFHAGNIRG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2
Molecular weight204.65 g/mol
IUPAC nameethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate;hydrochloride
InChIKeyQZGZCHFHAGNIRG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NN=C1C)C.Cl

Computed by PubChem (NCBI)