CAS 1641401-33-3 appears in our catalog under these names: (2R)-2-Amino-2-(6-methoxy(3-pyridyl))ethan-1-ol hydrochloride, 95%, (2R)-2-AMINO-2-(6-METHOXY(3-PYRIDYL))ETHAN-1-OL HCL, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2R)-2-amino-2-(6-methoxy-3-pyridinyl)ethanol;hydrochloride (CAS 1641401-33-3) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: (2R)-2-amino-2-(6-methoxy-3-pyridinyl)ethanol;hydrochloride. InChIKey: AUQJXHVNUMBQPC-FJXQXJEOSA-N.
| Molecular formula | C8H13ClN2O2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | (2R)-2-amino-2-(6-methoxy-3-pyridinyl)ethanol;hydrochloride |
| InChIKey | AUQJXHVNUMBQPC-FJXQXJEOSA-N |
| SMILES | COC1=NC=C(C=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)