Products 1375084-47-1

CAS 1375084-47-1 is the registry number for 4-(Aminomethyl)-1h-pyrrole-2-carboxylic acid ethyl ester hydrochloride, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(aminomethyl)-1H-pyrrole-2-carboxylate;hydrochloride (CAS 1375084-47-1) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: ethyl 4-(aminomethyl)-1H-pyrrole-2-carboxylate;hydrochloride. InChIKey: POZKLGCSWZVYRM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2
Molecular weight204.65 g/mol
IUPAC nameethyl 4-(aminomethyl)-1H-pyrrole-2-carboxylate;hydrochloride
InChIKeyPOZKLGCSWZVYRM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=CN1)CN.Cl

Computed by PubChem (NCBI)