Products 1609395-88-1

CAS 1609395-88-1 is the registry number for 3-(3,5-Dimethyl-1h-pyrazol-1-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethylpyrazol-1-yl)propanoic acid;hydrochloride (CAS 1609395-88-1) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: 3-(3,5-dimethylpyrazol-1-yl)propanoic acid;hydrochloride. InChIKey: AUHLOVSNZNZVSC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2
Molecular weight204.65 g/mol
IUPAC name3-(3,5-dimethylpyrazol-1-yl)propanoic acid;hydrochloride
InChIKeyAUHLOVSNZNZVSC-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CCC(=O)O)C.Cl

Computed by PubChem (NCBI)