Products 40119-17-3

CAS 40119-17-3 appears in our catalog under these names: 3,4-Dimethoxyphenylhydrazine hydrochloride, 95%, (3,4-Dimethoxyphenyl)hydrazine hydrochloride 95%, (3,4-Dimethoxyphenyl)hydrazine hydrochloride, 95%, 95%, (3,4-Dimethoxyphenyl)hydrazine (hydrochloride), 99.84%, (3,4-Dimethoxyphenyl)hydrazine hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 50mg, 5 g, 500 mg, 250 mg.

Structural formula: {0} (CAS {1})

(3,4-dimethoxyphenyl)hydrazine;hydrochloride (CAS 40119-17-3) is a chemical compound with the molecular formula C8H13ClN2O2 and a molecular weight of 204.65 g/mol. IUPAC name: (3,4-dimethoxyphenyl)hydrazine;hydrochloride. InChIKey: HRSRMSMAVYUKRC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2
Molecular weight204.65 g/mol
IUPAC name(3,4-dimethoxyphenyl)hydrazine;hydrochloride
InChIKeyHRSRMSMAVYUKRC-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)NN)OC.Cl

Computed by PubChem (NCBI)