Products 1285576-04-6
CAS 1285576-04-6 is the registry number for 5-bromo-2-methoxy-3-(trifluoromethoxy)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2-methoxy-3-(trifluoromethoxy)benzaldehyde (CAS 1285576-04-6) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 5-bromo-2-methoxy-3-(trifluoromethoxy)benzaldehyde. InChIKey: OUAMAMSZFYYEJN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 5-bromo-2-methoxy-3-(trifluoromethoxy)benzaldehyde |
| InChIKey | OUAMAMSZFYYEJN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1OC(F)(F)F)Br)C=O |
Computed by PubChem (NCBI)