Products 1286579-72-3
CAS 1286579-72-3 is the registry number for Aloe–emodin–d5. Offered by: GLPBio. Available pack sizes: 5mg.
1,2,3,6,8-pentadeuterio-4,5-dihydroxy-7-(hydroxymethyl)anthracene-9,10-dione (CAS 1286579-72-3) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 275.27 g/mol. IUPAC name: 1,2,3,6,8-pentadeuterio-4,5-dihydroxy-7-(hydroxymethyl)anthracene-9,10-dione. InChIKey: YDQWDHRMZQUTBA-RALIUCGRSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | 1,2,3,6,8-pentadeuterio-4,5-dihydroxy-7-(hydroxymethyl)anthracene-9,10-dione |
| InChIKey | YDQWDHRMZQUTBA-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C1[2H])O)C(=O)C3=C(C2=O)C(=C(C(=C3O)[2H])CO)[2H])[2H] |
Computed by PubChem (NCBI)