CAS 1286734-71-1 appears in our catalog under these names: (2R,3S)-1,2,3,4-tetrahydro-1,4-methanonaphthalene-2,3-diol, 98%, 98%, rel-(2R,3S)-1,2,3,4-Tetrahydro-1,4-methanonaphthalene-2,3-diol, 99.91%, (2R,3S)-1,2,3,4-TETRAHYDRO-1,4-METHANONAPHTHALENE-2,3-DIOL, 98%, (2R,3S)-1,2,3,4-tetrahydro-1,4-methanonaphthalene-2,3-diol, 95%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500 mg.
(9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol (CAS 1286734-71-1) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol. InChIKey: KKBAQAHAWLUGNK-HWACXVBKSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (9S,10R)-tricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-diol |
| InChIKey | KKBAQAHAWLUGNK-HWACXVBKSA-N |
| SMILES | C1C2[C@@H]([C@@H](C1C3=CC=CC=C23)O)O |
Computed by PubChem (NCBI)