Products 1286734-89-1
CAS 1286734-89-1 appears in our catalog under these names: 1-(4,5-Dichloro-2-fluorophenyl)ethan-1-one, 95%, 1-(4,5-Dichloro-2-fluorophenyl)ethanone 99%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
1-(4,5-dichloro-2-fluorophenyl)ethanone (CAS 1286734-89-1) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 1-(4,5-dichloro-2-fluorophenyl)ethanone. InChIKey: NLCLBCVKLGWCFE-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 1-(4,5-dichloro-2-fluorophenyl)ethanone |
| InChIKey | NLCLBCVKLGWCFE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1F)Cl)Cl |
Computed by PubChem (NCBI)