CAS 299411-67-9 appears in our catalog under these names: 2-Chloro-1-(4-chloro-2-fluorophenyl)ethanone, 95%, 2-Chloro-1-(4-chloro-2-fluorophenyl)ethanone, 97%, 2–Chloro–1–(4–chloro–2–fluorophenyl)ethanone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-1-(4-chloro-2-fluorophenyl)ethanone (CAS 299411-67-9) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 2-chloro-1-(4-chloro-2-fluorophenyl)ethanone. InChIKey: FYZHQRGIHWWQLB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 2-chloro-1-(4-chloro-2-fluorophenyl)ethanone |
| InChIKey | FYZHQRGIHWWQLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C(=O)CCl |
Computed by PubChem (NCBI)