CAS 916420-72-9 is the registry number for 3',6'-Dichloro-2'-fluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3,6-dichloro-2-fluorophenyl)ethanone (CAS 916420-72-9) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 1-(3,6-dichloro-2-fluorophenyl)ethanone. InChIKey: KIPVBHCZTSPODV-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 1-(3,6-dichloro-2-fluorophenyl)ethanone |
| InChIKey | KIPVBHCZTSPODV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1F)Cl)Cl |
Computed by PubChem (NCBI)