CAS 290835-85-7 appears in our catalog under these names: 2',6'–Dichloro–3'–fluoroacetophenone, 2',6'-Dichloro-3'-fluoroacetophenone, >97.0%(GC), 2,6-Dichloro-3-fluoroacetophenone, 97%, 2',6'-Dichloro-3'-fluoroacetophenone 98%, 2',6'-Dichloro-3'-fluoroacetophenone. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 500g, 5g, 25g, 100g, 10g, 1000g, 1g, 250g.
1-(2,6-dichloro-3-fluorophenyl)ethanone (CAS 290835-85-7) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 1-(2,6-dichloro-3-fluorophenyl)ethanone. InChIKey: VJBFZHHRVCPAPZ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-fluorophenyl)ethanone |
| InChIKey | VJBFZHHRVCPAPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1Cl)F)Cl |
Computed by PubChem (NCBI)