CAS 870704-16-8 appears in our catalog under these names: 2',3'-Dichloro-6'-fluoroacetophenone, 95%, 1-(2,3-Dichloro-6-fluorophenyl)ethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
1-(2,3-dichloro-6-fluorophenyl)ethanone (CAS 870704-16-8) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 1-(2,3-dichloro-6-fluorophenyl)ethanone. InChIKey: VHFIYTUVCUSGMN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 1-(2,3-dichloro-6-fluorophenyl)ethanone |
| InChIKey | VHFIYTUVCUSGMN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1Cl)Cl)F |
Computed by PubChem (NCBI)