CAS 261762-81-6 appears in our catalog under these names: 6-Chloro-2-fluoro-3-methylbenzoylchloride, 95%, 2-Chloro-6-fluoro-3-methylbenzoyl chloride, 2-Chloro-6-fluoro-3-methylbenzoyl chloride, 95%. Offered by: Chemat Brand, Fluorochem, Combi-blocks. Available pack sizes: on request, 1g, 5g, 25g.
2-chloro-6-fluoro-3-methylbenzoyl chloride (CAS 261762-81-6) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 2-chloro-6-fluoro-3-methylbenzoyl chloride. InChIKey: XJFKTIHKOKWAEF-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3-methylbenzoyl chloride |
| InChIKey | XJFKTIHKOKWAEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)