CAS 1289015-46-8 is the registry number for 2-Formyl-5-(trifluoromethyl)benzonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 100mg.
2-formyl-5-(trifluoromethyl)benzonitrile (CAS 1289015-46-8) is a chemical compound with the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. IUPAC name: 2-formyl-5-(trifluoromethyl)benzonitrile. InChIKey: PWEJELZGJXQNKW-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 2-formyl-5-(trifluoromethyl)benzonitrile |
| InChIKey | PWEJELZGJXQNKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C#N)C=O |
Computed by PubChem (NCBI)