CAS 842140-50-5 is the registry number for 3-Oxo-3-(3,4,5-trifluorophenyl)propanenitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-oxo-3-(3,4,5-trifluorophenyl)propanenitrile (CAS 842140-50-5) is a chemical compound with the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. IUPAC name: 3-oxo-3-(3,4,5-trifluorophenyl)propanenitrile. InChIKey: BRAUWLHJOAFANC-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 3-oxo-3-(3,4,5-trifluorophenyl)propanenitrile |
| InChIKey | BRAUWLHJOAFANC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(=O)CC#N |
Computed by PubChem (NCBI)