CAS 23516-85-0 appears in our catalog under these names: 4-(2,2,2-Trifluoroacetyl)benzonitrile 95%, 4'-Cyano-2,2,2-trifluoroacetophenone, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(2,2,2-trifluoroacetyl)benzonitrile (CAS 23516-85-0) is a chemical compound with the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. IUPAC name: 4-(2,2,2-trifluoroacetyl)benzonitrile. InChIKey: NBHZKHMJVZRCIY-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroacetyl)benzonitrile |
| InChIKey | NBHZKHMJVZRCIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)