Products 1289208-38-3
CAS 1289208-38-3 appears in our catalog under these names: 5-Formyl-2-(trifluoromethyl)benzonitrile 95%, 5-Formyl-2-(trifluoromethyl)benzonitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-formyl-2-(trifluoromethyl)benzonitrile (CAS 1289208-38-3) is a chemical compound with the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. IUPAC name: 5-formyl-2-(trifluoromethyl)benzonitrile. InChIKey: HFGQLXCDZIYFJF-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 5-formyl-2-(trifluoromethyl)benzonitrile |
| InChIKey | HFGQLXCDZIYFJF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)C#N)C(F)(F)F |
Computed by PubChem (NCBI)