CAS 23568-85-6 is the registry number for 3-(Trifluoroacetyl)Benzonitrile. Offered by: TRC. Available pack sizes: 1g.
3-(2,2,2-trifluoroacetyl)benzonitrile (CAS 23568-85-6) is a chemical compound with the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. IUPAC name: 3-(2,2,2-trifluoroacetyl)benzonitrile. InChIKey: MWGVWNKZGXDSRJ-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroacetyl)benzonitrile |
| InChIKey | MWGVWNKZGXDSRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)C(F)(F)F)C#N |
Computed by PubChem (NCBI)