CAS 467457-04-1 is the registry number for 4,5,7-Trifluoro-1H-indole-3-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,5,7-trifluoro-1H-indole-3-carbaldehyde (CAS 467457-04-1) is a chemical compound with the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. IUPAC name: 4,5,7-trifluoro-1H-indole-3-carbaldehyde. InChIKey: HLQHYSGZOYYOGY-UHFFFAOYSA-N.
| Molecular formula | C9H4F3NO |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 4,5,7-trifluoro-1H-indole-3-carbaldehyde |
| InChIKey | HLQHYSGZOYYOGY-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=CN2)C=O)C(=C1F)F)F |
Computed by PubChem (NCBI)