CAS 129295-33-6 appears in our catalog under these names: 5,6-Difluoro-1h-indazole-3-carboxylic acid, 95%, 5,6–DIFLUORO–1H–INDAZOLE–3–CARBOXYLIC ACID, 5,6-Difluoro-1H-indazole-3-carboxylic acid 90%, 5,6-DIFLUORO-1H-INDAZOLE-3-CARBOXYLIC ACID, 90%, 90%, 5,6-difluoro-1H-indazole-3-carboxylic acid, 90%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
5,6-difluoro-1H-indazole-3-carboxylic acid (CAS 129295-33-6) is a chemical compound with the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. IUPAC name: 5,6-difluoro-1H-indazole-3-carboxylic acid. InChIKey: NKVHNRMDLDYXKZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F2N2O2 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 5,6-difluoro-1H-indazole-3-carboxylic acid |
| InChIKey | NKVHNRMDLDYXKZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NN=C2C(=O)O |
Computed by PubChem (NCBI)