Products 2377370-09-5

CAS 2377370-09-5 is the registry number for 2-(5-Cyanopyridin-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-cyano-2-pyridinyl)-2,2-difluoroacetic acid (CAS 2377370-09-5) is a chemical compound with the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. IUPAC name: 2-(5-cyano-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: UJKYLLQWGREHID-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F2N2O2
Molecular weight198.13 g/mol
IUPAC name2-(5-cyano-2-pyridinyl)-2,2-difluoroacetic acid
InChIKeyUJKYLLQWGREHID-UHFFFAOYSA-N
SMILESC1=CC(=NC=C1C#N)C(C(=O)O)(F)F

Computed by PubChem (NCBI)