CAS 2138239-73-1 is the registry number for 5,6-Difluoro-3-nitro-1H-indole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-difluoro-3-nitro-1H-indole (CAS 2138239-73-1) is a chemical compound with the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. IUPAC name: 5,6-difluoro-3-nitro-1H-indole. InChIKey: RINNYXGZXYYHFH-UHFFFAOYSA-N.
| Molecular formula | C8H4F2N2O2 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 5,6-difluoro-3-nitro-1H-indole |
| InChIKey | RINNYXGZXYYHFH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)