Products 2900373-73-9
CAS 2900373-73-9 is the registry number for 7-Amino-2,2-difluorobenzo[d][1,3]dioxole-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-2,2-difluoro-1,3-benzodioxole-4-carbonitrile (CAS 2900373-73-9) is a chemical compound with the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. IUPAC name: 7-amino-2,2-difluoro-1,3-benzodioxole-4-carbonitrile. InChIKey: UWWMUVVKHLOJCU-UHFFFAOYSA-N.
| Molecular formula | C8H4F2N2O2 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 7-amino-2,2-difluoro-1,3-benzodioxole-4-carbonitrile |
| InChIKey | UWWMUVVKHLOJCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1C#N)OC(O2)(F)F)N |
Computed by PubChem (NCBI)