CAS 1341663-05-5 is the registry number for 5-(2,4-Difluorophenyl)-1,3,4-oxadiazol-2-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-(2,4-difluorophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 1341663-05-5) is a chemical compound with the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: HWDCTYHFYFHAOF-UHFFFAOYSA-N.
| Molecular formula | C8H4F2N2O2 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | HWDCTYHFYFHAOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C2=NNC(=O)O2 |
Computed by PubChem (NCBI)