CAS 1393726-72-1 is the registry number for 8,8–Difluoro–1,6–naphthyridine–5,7(6H,8H)–dione. Offered by: GLPBio. Available pack sizes: 100mg.
8,8-difluoro-1,6-naphthyridine-5,7-dione (CAS 1393726-72-1) is a chemical compound with the molecular formula C8H4F2N2O2 and a molecular weight of 198.13 g/mol. IUPAC name: 8,8-difluoro-1,6-naphthyridine-5,7-dione. InChIKey: YBIJKYHTXXIZLR-UHFFFAOYSA-N.
| Molecular formula | C8H4F2N2O2 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 8,8-difluoro-1,6-naphthyridine-5,7-dione |
| InChIKey | YBIJKYHTXXIZLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(C(=O)NC2=O)(F)F)N=C1 |
Computed by PubChem (NCBI)