Products 129748-28-3
CAS 129748-28-3 is the registry number for Cerpegin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,1,5-trimethylfuro[3,4-c]pyridine-3,4-dione (CAS 129748-28-3) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 1,1,5-trimethylfuro[3,4-c]pyridine-3,4-dione. InChIKey: ANFMKCSQXDEJMT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 1,1,5-trimethylfuro[3,4-c]pyridine-3,4-dione |
| InChIKey | ANFMKCSQXDEJMT-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=O)N(C=C2)C)C(=O)O1)C |
Computed by PubChem (NCBI)