CAS 129931-45-9 appears in our catalog under these names: 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoic acid, 95%, 3–Chloro–2–fluoro–5–(trifluoromethyl)benzoic acid, 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoic acid 98%, 3-Chloro-2-Fluoro-5-(Trifluoromethyl)Benzoic Acid, 97%, 97%, 3-Chloro-2-fluoro-5-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 10g.
3-chloro-2-fluoro-5-(trifluoromethyl)benzoic acid (CAS 129931-45-9) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 3-chloro-2-fluoro-5-(trifluoromethyl)benzoic acid. InChIKey: UINXNXRHKMRASA-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 3-chloro-2-fluoro-5-(trifluoromethyl)benzoic acid |
| InChIKey | UINXNXRHKMRASA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)