CAS 886497-89-8 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethoxy)benzoyl chloride, 95%, 2-Fluoro-5-(trifluoromethoxy)benzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-fluoro-5-(trifluoromethoxy)benzoyl chloride (CAS 886497-89-8) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethoxy)benzoyl chloride. InChIKey: DMQPJSTXNSFZCH-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethoxy)benzoyl chloride |
| InChIKey | DMQPJSTXNSFZCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)Cl)F |
Computed by PubChem (NCBI)