CAS 1807210-92-9 appears in our catalog under these names: 5-Chloro-2-fluoro-4-(trifluoromethyl)benzoic acid, 95%, 5-Chloro-2-fluoro-4-(trifluoromethyl)benzoic acid 98%, 5-Chloro-2-fluoro-4-(trifluoromethyl)benzoic Acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 25g.
5-chloro-2-fluoro-4-(trifluoromethyl)benzoic acid (CAS 1807210-92-9) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 5-chloro-2-fluoro-4-(trifluoromethyl)benzoic acid. InChIKey: KQKOUBKHCIQIHI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 5-chloro-2-fluoro-4-(trifluoromethyl)benzoic acid |
| InChIKey | KQKOUBKHCIQIHI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)