Products 1805955-65-0
CAS 1805955-65-0 appears in our catalog under these names: 2-Chloro-5-fluoro-3-(trifluoromethyl)benzoic acid, 95%, 2-Chloro-5-fluoro-3-(trifluoromethyl)benzoic Acid, >95% (HPLC), 2-Chloro-5-fluoro-3-(trifluoromethyl)benzoic acid, 97%, 2-Chloro-5-fluoro-3-(trifluoromethyl)benzoic acid, 2-Chloro-5-fluoro-3-(trifluoromethyl)benzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg, 10mg, 50mg.
2-chloro-5-fluoro-3-(trifluoromethyl)benzoic acid (CAS 1805955-65-0) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 2-chloro-5-fluoro-3-(trifluoromethyl)benzoic acid. InChIKey: VEGWJLXXACYSPJ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 2-chloro-5-fluoro-3-(trifluoromethyl)benzoic acid |
| InChIKey | VEGWJLXXACYSPJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)C(F)(F)F)F |
Computed by PubChem (NCBI)