Products 1807119-60-3
CAS 1807119-60-3 appears in our catalog under these names: 5-Chloro-2-fluoro-3-(trifluoromethyl)benzoic acid, 95%, 5-Chloro-2-fluoro-3-(trifluoromethyl)benzoic acid, 98%, 5-Chloro-2-fluoro-3-(trifluoromethyl)benzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
5-chloro-2-fluoro-3-(trifluoromethyl)benzoic acid (CAS 1807119-60-3) is a chemical compound with the molecular formula C8H3ClF4O2 and a molecular weight of 242.55 g/mol. IUPAC name: 5-chloro-2-fluoro-3-(trifluoromethyl)benzoic acid. InChIKey: KXXOBLVXFYHFBO-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O2 |
|---|---|
| Molecular weight | 242.55 g/mol |
| IUPAC name | 5-chloro-2-fluoro-3-(trifluoromethyl)benzoic acid |
| InChIKey | KXXOBLVXFYHFBO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)